C21H13NO4 — CID 754025
(4E)-2-(1,3-benzodioxol-5-yl)-4-(naphthalen-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 754025) has the molecular formula C21H13NO4 and a molecular weight of 343.34 g/mol. Its IUPAC name is (4E)-2-(1,3-benzodioxol-5-yl)-4-(naphthalen-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(1,3-benzodioxol-5-yl)-4-(naphthalen-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 754025 |
| Molecular Formula | C21H13NO4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (4E)-2-(1,3-benzodioxol-5-yl)-4-(naphthalen-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)=N/C1=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H13NO4/c23-21-17(10-13-5-6-14-3-1-2-4-15(14)9-13)22-20(26-21)16-7-8-18-19(11-16)25-12-24-18/h1-11H,12H2/b17-10+ |
| InChIKey | HIMSGGDEITVLNP-LICLKQGHSA-N |
| XLogP | 3.91 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|