C18H13NO6 — CID 101165416
(4E)-4-(1,3,4,6-benzotetraoxocin-8-ylmethylidene)-2-phenyl-1,3-oxazol-5-one (PubChem CID 101165416) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is (4E)-4-(1,3,4,6-benzotetraoxocin-8-ylmethylidene)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-(1,3,4,6-benzotetraoxocin-8-ylmethylidene)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 101165416 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (4E)-4-(1,3,4,6-benzotetraoxocin-8-ylmethylidene)-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C/c1ccc2c(c1)OCOOCO2 |
| InChI | InChI=1S/C18H13NO6/c20-18-14(19-17(25-18)13-4-2-1-3-5-13)8-12-6-7-15-16(9-12)22-11-24-23-10-21-15/h1-9H,10-11H2/b14-8+ |
| InChIKey | XXMOEONEPASKBG-RIYZIHGNSA-N |
| XLogP | 2.67 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|