C17H10ClNO4 — CID 5399512
(4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 5399512) has the molecular formula C17H10ClNO4 and a molecular weight of 327.72 g/mol. Its IUPAC name is (4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5399512 |
| Molecular Formula | C17H10ClNO4 |
| Molecular Weight | 327.72 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=N/C1=C\c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H10ClNO4/c18-12-8-15-14(21-9-22-15)7-11(12)6-13-17(20)23-16(19-13)10-4-2-1-3-5-10/h1-8H,9H2/b13-6- |
| InChIKey | SKFJKNADDRJAML-MLPAPPSSSA-N |
| XLogP | 3.41 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|