C18H10BrNO6 — CID 2254285
(4Z)-2-(1,3-benzodioxol-5-yl)-4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 2254285) has the molecular formula C18H10BrNO6 and a molecular weight of 416.18 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2254285 |
| Molecular Formula | C18H10BrNO6 |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)=N/C1=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C18H10BrNO6/c19-11-6-16-15(24-8-25-16)5-10(11)3-12-18(21)26-17(20-12)9-1-2-13-14(4-9)23-7-22-13/h1-6H,7-8H2/b12-3- |
| InChIKey | JENFFMMDEGWRBU-BASWHVEKSA-N |
| XLogP | 3.25 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|