C19H15NO6 — CID 171982742
(4Z)-2-(1,3-benzodioxol-5-yl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 171982742) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 171982742 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccc(OC)c(/C=C2\N=C(c3ccc4c(c3)OCO4)OC2=O)c1 |
| InChI | InChI=1S/C19H15NO6/c1-22-13-4-6-15(23-2)12(7-13)8-14-19(21)26-18(20-14)11-3-5-16-17(9-11)25-10-24-16/h3-9H,10H2,1-2H3/b14-8- |
| InChIKey | KUTMCAOORIFJEZ-ZSOIEALJSA-N |
| XLogP | 2.78 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|