C19H13NO6 — CID 126196397
[2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 126196397) has the molecular formula C19H13NO6 and a molecular weight of 351.31 g/mol. Its IUPAC name is [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 126196397 |
| Molecular Formula | C19H13NO6 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1/C=C1/N=C(c2ccc3c(c2)OCO3)OC1=O |
| InChI | InChI=1S/C19H13NO6/c1-11(21)25-15-5-3-2-4-12(15)8-14-19(22)26-18(20-14)13-6-7-16-17(9-13)24-10-23-16/h2-9H,10H2,1H3/b14-8+ |
| InChIKey | LRBUSWVYHSEHMW-RIYZIHGNSA-N |
| XLogP | 2.69 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|