C27H21NO9 — CID 126195468
[2-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126195468) has the molecular formula C27H21NO9 and a molecular weight of 503.46 g/mol. Its IUPAC name is [2-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126195468 |
| Molecular Formula | C27H21NO9 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | [2-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1cc(C2=N/C(=C\c3ccccc3OC(=O)c3ccc4c(c3)OCO4)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C27H21NO9/c1-31-22-12-17(13-23(32-2)24(22)33-3)25-28-18(27(30)37-25)10-15-6-4-5-7-19(15)36-26(29)16-8-9-20-21(11-16)35-14-34-20/h4-13H,14H2,1-3H3/b18-10- |
| InChIKey | NCOHIZCZPLTTOU-ZDLGFXPLSA-N |
| XLogP | 4.00 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|