C27H23NO8 — CID 1336219
[2-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate (PubChem CID 1336219) has the molecular formula C27H23NO8 and a molecular weight of 489.48 g/mol. Its IUPAC name is [2-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 1336219 |
| Molecular Formula | C27H23NO8 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [2-[[2-(4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(C2=NC(=Cc3ccccc3OC(=O)c3cc(OC)c(OC)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H23NO8/c1-31-19-11-9-16(10-12-19)25-28-20(27(30)36-25)13-17-7-5-6-8-21(17)35-26(29)18-14-22(32-2)24(34-4)23(15-18)33-3/h5-15H,1-4H3 |
| InChIKey | HIJHPOQSVPWBCV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|