C26H19Br2NO7 — CID 126200825
[2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate (PubChem CID 126200825) has the molecular formula C26H19Br2NO7 and a molecular weight of 617.25 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126200825 |
| Molecular Formula | C26H19Br2NO7 |
| Molecular Weight | 617.25 g/mol |
| Exact Mass | 614.95 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)c3ccccc3)C(=O)O2)cc(OC)c1OC |
| InChI | InChI=1S/C26H19Br2NO7/c1-32-20-11-16(12-21(33-2)23(20)34-3)24-29-19(26(31)36-24)10-15-9-17(27)13-18(28)22(15)35-25(30)14-7-5-4-6-8-14/h4-13H,1-3H3/b19-10- |
| InChIKey | PNTKTIDSKSFWJD-GRSHGNNSSA-N |
| XLogP | 5.80 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.25 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|