C24H14Br2N2O6 — CID 126196099
[2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 126196099) has the molecular formula C24H14Br2N2O6 and a molecular weight of 586.19 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126196099 |
| Molecular Formula | C24H14Br2N2O6 |
| Molecular Weight | 586.19 g/mol |
| Exact Mass | 583.92 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | Cc1cccc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)c3ccc([N+](=O)[O-])cc3)C(=O)O2)c1 |
| InChI | InChI=1S/C24H14Br2N2O6/c1-13-3-2-4-15(9-13)22-27-20(24(30)34-22)11-16-10-17(25)12-19(26)21(16)33-23(29)14-5-7-18(8-6-14)28(31)32/h2-12H,1H3/b20-11- |
| InChIKey | UKFSRQPNKBIVPY-JAIQZWGSSA-N |
| XLogP | 5.99 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.19 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|