C22H19Br2NO7 — CID 126198950
[2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate (PubChem CID 126198950) has the molecular formula C22H19Br2NO7 and a molecular weight of 569.20 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 126198950 |
| Molecular Formula | C22H19Br2NO7 |
| Molecular Weight | 569.20 g/mol |
| Exact Mass | 566.95 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc(Br)cc1/C=C1\N=C(c2cc(OC)c(OC)c(OC)c2)OC1=O |
| InChI | InChI=1S/C22H19Br2NO7/c1-5-18(26)31-19-11(6-13(23)10-14(19)24)7-15-22(27)32-21(25-15)12-8-16(28-2)20(30-4)17(9-12)29-3/h6-10H,5H2,1-4H3/b15-7- |
| InChIKey | ZRSBVKJQHQZZRD-CHHVJCJISA-N |
| XLogP | 4.90 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|