C20H15Br2NO5 — CID 19662761
[2-bromo-4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] propanoate (PubChem CID 19662761) has the molecular formula C20H15Br2NO5 and a molecular weight of 509.15 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] propanoate.
| Compound Name | [2-bromo-4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] propanoate |
|---|---|
| PubChem CID | 19662761 |
| Molecular Formula | C20H15Br2NO5 |
| Molecular Weight | 509.15 g/mol |
| Exact Mass | 506.93 |
| IUPAC Name | [2-bromo-4-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Br)cc(/C=C2\N=C(c3ccc(Br)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H15Br2NO5/c1-3-17(24)27-18-14(22)8-11(10-16(18)26-2)9-15-20(25)28-19(23-15)12-4-6-13(21)7-5-12/h4-10H,3H2,1-2H3/b15-9- |
| InChIKey | WNXXQHGGJGBGLY-DHDCSXOGSA-N |
| XLogP | 4.88 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.15 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|