C29H25NO10 — CID 126201868
[2-ethoxy-4-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126201868) has the molecular formula C29H25NO10 and a molecular weight of 547.52 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-ethoxy-4-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126201868 |
| Molecular Formula | C29H25NO10 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[5-oxo-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOc1cc(/C=C2\N=C(c3cc(OC)c(OC)c(OC)c3)OC2=O)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H25NO10/c1-5-36-22-11-16(6-8-21(22)39-28(31)17-7-9-20-23(12-17)38-15-37-20)10-19-29(32)40-27(30-19)18-13-24(33-2)26(35-4)25(14-18)34-3/h6-14H,5,15H2,1-4H3/b19-10- |
| InChIKey | UPCVDDFUQCGQEL-GRSHGNNSSA-N |
| XLogP | 4.40 |
| TPSA | 120.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|