C27H21NO7 — CID 4223289
[2-ethoxy-4-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 4223289) has the molecular formula C27H21NO7 and a molecular weight of 471.47 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-ethoxy-4-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 4223289 |
| Molecular Formula | C27H21NO7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [2-ethoxy-4-[[2-(3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | CCOc1cc(C=C2N=C(c3cccc(C)c3)OC2=O)ccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H21NO7/c1-3-31-23-13-17(12-20-27(30)35-25(28-20)18-6-4-5-16(2)11-18)7-9-22(23)34-26(29)19-8-10-21-24(14-19)33-15-32-21/h4-14H,3,15H2,1-2H3 |
| InChIKey | MYUSYPULTGSEII-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|