C27H23NO6 — CID 4207172
[2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methoxybenzoate (PubChem CID 4207172) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 4207172 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methoxybenzoate |
| SMILES | CCOc1cc(C=C2N=C(c3ccc(C)cc3)OC2=O)ccc1OC(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C27H23NO6/c1-4-32-24-15-18(10-13-23(24)33-26(29)20-6-5-7-21(16-20)31-3)14-22-27(30)34-25(28-22)19-11-8-17(2)9-12-19/h5-16H,4H2,1-3H3 |
| InChIKey | WEBJAFRAXSPDAK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|