C28H25NO6 — CID 126015479
[2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 126015479) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126015479 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[2-(4-ethoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4ccc(C)cc4)c(OCC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C28H25NO6/c1-4-32-22-13-11-20(12-14-22)26-29-23(28(31)35-26)16-19-8-15-24(25(17-19)33-5-2)34-27(30)21-9-6-18(3)7-10-21/h6-17H,4-5H2,1-3H3/b23-16- |
| InChIKey | OWLXSFVIYGPTIL-KQWNVCNZSA-N |
| XLogP | 5.36 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|