C28H24FNO6 — CID 126012478
[4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 126012478) has the molecular formula C28H24FNO6 and a molecular weight of 489.50 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 126012478 |
| Molecular Formula | C28H24FNO6 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [4-[(Z)-[2-(4-butoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | CCCCOc1ccc(C2=N/C(=C\c3ccc(OC(=O)c4ccc(F)cc4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C28H24FNO6/c1-3-4-15-34-22-12-8-19(9-13-22)26-30-23(28(32)36-26)16-18-5-14-24(25(17-18)33-2)35-27(31)20-6-10-21(29)11-7-20/h5-14,16-17H,3-4,15H2,1-2H3/b23-16- |
| InChIKey | XOYDOVOKVXYMCF-KQWNVCNZSA-N |
| XLogP | 5.58 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|