C31H41NO5 — CID 170458914
(4Z)-2-(4-hexoxyphenyl)-4-[(3-methoxy-4-octoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 170458914) has the molecular formula C31H41NO5 and a molecular weight of 507.67 g/mol. Its IUPAC name is (4Z)-2-(4-hexoxyphenyl)-4-[(3-methoxy-4-octoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-hexoxyphenyl)-4-[(3-methoxy-4-octoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 170458914 |
| Molecular Formula | C31H41NO5 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | (4Z)-2-(4-hexoxyphenyl)-4-[(3-methoxy-4-octoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCCCCCOc1ccc(/C=C2\N=C(c3ccc(OCCCCCC)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C31H41NO5/c1-4-6-8-10-11-13-21-36-28-19-14-24(23-29(28)34-3)22-27-31(33)37-30(32-27)25-15-17-26(18-16-25)35-20-12-9-7-5-2/h14-19,22-23H,4-13,20-21H2,1-3H3/b27-22- |
| InChIKey | XNUDNMRQJNEEGM-QYQHSDTDSA-N |
| XLogP | 7.74 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|