C21H20INO4 — CID 19671608
(4Z)-2-(4-iodo-3-methylphenyl)-4-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19671608) has the molecular formula C21H20INO4 and a molecular weight of 477.30 g/mol. Its IUPAC name is (4Z)-2-(4-iodo-3-methylphenyl)-4-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-iodo-3-methylphenyl)-4-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19671608 |
| Molecular Formula | C21H20INO4 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | (4Z)-2-(4-iodo-3-methylphenyl)-4-[(3-methoxy-4-propoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCOc1ccc(/C=C2\N=C(c3ccc(I)c(C)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H20INO4/c1-4-9-26-18-8-5-14(12-19(18)25-3)11-17-21(24)27-20(23-17)15-6-7-16(22)13(2)10-15/h5-8,10-12H,4,9H2,1-3H3/b17-11- |
| InChIKey | COJXNSKECZSDFS-BOPFTXTBSA-N |
| XLogP | 4.74 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|