C20H16INO5 — CID 19671529
[4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 19671529) has the molecular formula C20H16INO5 and a molecular weight of 477.25 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 19671529 |
| Molecular Formula | C20H16INO5 |
| Molecular Weight | 477.25 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | [4-[(Z)-[2-(4-iodo-3-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(I)c(C)c3)OC2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C20H16INO5/c1-11-8-14(5-6-15(11)21)19-22-16(20(24)27-19)9-13-4-7-17(26-12(2)23)18(10-13)25-3/h4-10H,1-3H3/b16-9- |
| InChIKey | NAAZDBZJIQIYMO-SXGWCWSVSA-N |
| XLogP | 3.88 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|