C19H12BrI2NO5 — CID 19671111
[4-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 19671111) has the molecular formula C19H12BrI2NO5 and a molecular weight of 668.02 g/mol. Its IUPAC name is [4-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 19671111 |
| Molecular Formula | C19H12BrI2NO5 |
| Molecular Weight | 668.02 g/mol |
| Exact Mass | 666.80 |
| IUPAC Name | [4-[(Z)-[2-(3-bromo-4-iodophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(I)c(Br)c3)OC2=O)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C19H12BrI2NO5/c1-9(24)27-17-14(22)5-10(7-16(17)26-2)6-15-19(25)28-18(23-15)11-3-4-13(21)12(20)8-11/h3-8H,1-2H3/b15-6- |
| InChIKey | FNCQOSKQRJILRY-UUASQNMZSA-N |
| XLogP | 4.94 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.02 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|