C20H14BrClINO4 — CID 19671089
(4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 19671089) has the molecular formula C20H14BrClINO4 and a molecular weight of 574.60 g/mol. Its IUPAC name is (4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19671089 |
| Molecular Formula | C20H14BrClINO4 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 572.88 |
| IUPAC Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[(3-chloro-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | C=CCOc1c(Cl)cc(/C=C2\N=C(c3ccc(I)c(Br)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H14BrClINO4/c1-3-6-27-18-14(22)7-11(9-17(18)26-2)8-16-20(25)28-19(24-16)12-4-5-15(23)13(21)10-12/h3-5,7-10H,1,6H2,2H3/b16-8- |
| InChIKey | UDFBVVMPUBFHAM-PXNMLYILSA-N |
| XLogP | 5.62 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|