C24H15BrClFINO4 — CID 19671172
(4Z)-2-(3-bromo-4-iodophenyl)-4-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 19671172) has the molecular formula C24H15BrClFINO4 and a molecular weight of 642.65 g/mol. Its IUPAC name is (4Z)-2-(3-bromo-4-iodophenyl)-4-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19671172 |
| Molecular Formula | C24H15BrClFINO4 |
| Molecular Weight | 642.65 g/mol |
| Exact Mass | 640.89 |
| IUPAC Name | (4Z)-2-(3-bromo-4-iodophenyl)-4-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(I)c(Br)c3)OC2=O)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H15BrClFINO4/c1-31-21-10-14(8-18(26)22(21)32-12-13-2-5-16(27)6-3-13)9-20-24(30)33-23(29-20)15-4-7-19(28)17(25)11-15/h2-11H,12H2,1H3/b20-9- |
| InChIKey | RENYGRJNTZNCNW-UKWGHVSLSA-N |
| XLogP | 6.78 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.65 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|