C23H22INO5 — CID 5175330
[4-[[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate (PubChem CID 5175330) has the molecular formula C23H22INO5 and a molecular weight of 519.34 g/mol. Its IUPAC name is [4-[[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate.
| Compound Name | [4-[[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 5175330 |
| Molecular Formula | C23H22INO5 |
| Molecular Weight | 519.34 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | [4-[[2-(4-tert-butylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-iodo-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C2N=C(c3ccc(C(C)(C)C)cc3)OC2=O)cc(I)c1OC(C)=O |
| InChI | InChI=1S/C23H22INO5/c1-13(26)29-20-17(24)10-14(12-19(20)28-5)11-18-22(27)30-21(25-18)15-6-8-16(9-7-15)23(2,3)4/h6-12H,1-5H3 |
| InChIKey | MWXKTSMTTSUOID-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|