C20H15Cl2NO6 — CID 19672584
[4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethoxyphenyl] acetate (PubChem CID 19672584) has the molecular formula C20H15Cl2NO6 and a molecular weight of 436.25 g/mol. Its IUPAC name is [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethoxyphenyl] acetate.
| Compound Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 19672584 |
| Molecular Formula | C20H15Cl2NO6 |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | [4-[(Z)-[2-(3,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2,6-dimethoxyphenyl] acetate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(Cl)c(Cl)c3)OC2=O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C20H15Cl2NO6/c1-10(24)28-18-16(26-2)7-11(8-17(18)27-3)6-15-20(25)29-19(23-15)12-4-5-13(21)14(22)9-12/h4-9H,1-3H3/b15-6- |
| InChIKey | CFPKYWQRCVHKCL-UUASQNMZSA-N |
| XLogP | 4.28 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|