C15H15NO6 — CID 813224
[2,6-dimethoxy-4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] acetate (PubChem CID 813224) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 813224 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [2,6-dimethoxy-4-[(2-methyl-5-oxo-1,3-oxazol-4-ylidene)methyl]phenyl] acetate |
| SMILES | COc1cc(C=C2N=C(C)OC2=O)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C15H15NO6/c1-8-16-11(15(18)21-8)5-10-6-12(19-3)14(22-9(2)17)13(7-10)20-4/h5-7H,1-4H3 |
| InChIKey | MGMFAWDKIPZJKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|