C22H17NO8 — CID 3272863
[2,3-diacetyloxy-5-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate (PubChem CID 3272863) has the molecular formula C22H17NO8 and a molecular weight of 423.38 g/mol. Its IUPAC name is [2,3-diacetyloxy-5-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate.
| Compound Name | [2,3-diacetyloxy-5-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 3272863 |
| Molecular Formula | C22H17NO8 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [2,3-diacetyloxy-5-[(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C=C2N=C(c3ccccc3)OC2=O)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C22H17NO8/c1-12(24)28-18-10-15(11-19(29-13(2)25)20(18)30-14(3)26)9-17-22(27)31-21(23-17)16-7-5-4-6-8-16/h4-11H,1-3H3 |
| InChIKey | SGDSUOBLQGXIAW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 117.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|