C26H21NO4 — CID 19665351
[2,6-dimethyl-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 19665351) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2,6-dimethyl-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethyl-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 19665351 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [2,6-dimethyl-4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(/C=C2\N=C(c3ccc(-c4ccccc4)cc3)OC2=O)cc1C |
| InChI | InChI=1S/C26H21NO4/c1-16-13-19(14-17(2)24(16)30-18(3)28)15-23-26(29)31-25(27-23)22-11-9-21(10-12-22)20-7-5-4-6-8-20/h4-15H,1-3H3/b23-15- |
| InChIKey | OLUVRVIBAWVAHF-HAHDFKILSA-N |
| XLogP | 5.24 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|