C19H13Br2NO5 — CID 4518499
[2,6-dibromo-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 4518499) has the molecular formula C19H13Br2NO5 and a molecular weight of 495.12 g/mol. Its IUPAC name is [2,6-dibromo-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dibromo-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 4518499 |
| Molecular Formula | C19H13Br2NO5 |
| Molecular Weight | 495.12 g/mol |
| Exact Mass | 492.92 |
| IUPAC Name | [2,6-dibromo-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | COc1cccc(C2=NC(=Cc3cc(Br)c(OC(C)=O)c(Br)c3)C(=O)O2)c1 |
| InChI | InChI=1S/C19H13Br2NO5/c1-10(23)26-17-14(20)6-11(7-15(17)21)8-16-19(24)27-18(22-16)12-4-3-5-13(9-12)25-2/h3-9H,1-2H3 |
| InChIKey | KAHQONTXFGNIAI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.12 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|