C19H14BrNO5 — CID 6525739
[3-[(Z)-[2-(2-bromo-4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 6525739) has the molecular formula C19H14BrNO5 and a molecular weight of 416.23 g/mol. Its IUPAC name is [3-[(Z)-[2-(2-bromo-4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [3-[(Z)-[2-(2-bromo-4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 6525739 |
| Molecular Formula | C19H14BrNO5 |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | [3-[(Z)-[2-(2-bromo-4-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | COc1ccc(C2=N/C(=C\c3cccc(OC(C)=O)c3)C(=O)O2)c(Br)c1 |
| InChI | InChI=1S/C19H14BrNO5/c1-11(22)25-14-5-3-4-12(8-14)9-17-19(23)26-18(21-17)15-7-6-13(24-2)10-16(15)20/h3-10H,1-2H3/b17-9- |
| InChIKey | RTRBSYKTKPWNTM-MFOYZWKCSA-N |
| XLogP | 3.73 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|