C18H11F2NO4 — CID 34086596
[3-[(Z)-[2-(2,4-difluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 34086596) has the molecular formula C18H11F2NO4 and a molecular weight of 343.29 g/mol. Its IUPAC name is [3-[(Z)-[2-(2,4-difluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [3-[(Z)-[2-(2,4-difluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 34086596 |
| Molecular Formula | C18H11F2NO4 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [3-[(Z)-[2-(2,4-difluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(/C=C2\N=C(c3ccc(F)cc3F)OC2=O)c1 |
| InChI | InChI=1S/C18H11F2NO4/c1-10(22)24-13-4-2-3-11(7-13)8-16-18(23)25-17(21-16)14-6-5-12(19)9-15(14)20/h2-9H,1H3/b16-8- |
| InChIKey | URXUABYMASJWLW-PXNMLYILSA-N |
| XLogP | 3.23 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|