C24H16ClNO5 — CID 175547428
[4-chloro-2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-2-yl]phenyl] acetate (PubChem CID 175547428) has the molecular formula C24H16ClNO5 and a molecular weight of 433.85 g/mol. Its IUPAC name is [4-chloro-2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-2-yl]phenyl] acetate.
| Compound Name | [4-chloro-2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 175547428 |
| Molecular Formula | C24H16ClNO5 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [4-chloro-2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-1,3-oxazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Cl)cc1C1=NC(=Cc2cccc(Oc3ccccc3)c2)C(=O)O1 |
| InChI | InChI=1S/C24H16ClNO5/c1-15(27)29-22-11-10-17(25)14-20(22)23-26-21(24(28)31-23)13-16-6-5-9-19(12-16)30-18-7-3-2-4-8-18/h2-14H,1H3 |
| InChIKey | HLDDANGJJWRXHG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|