C17H11ClN2O4 — CID 9052597
[3-[(Z)-[2-(4-chloro-2-pyridinyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 9052597) has the molecular formula C17H11ClN2O4 and a molecular weight of 342.74 g/mol. Its IUPAC name is [3-[(Z)-[2-(4-chloro-2-pyridinyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [3-[(Z)-[2-(4-chloro-2-pyridinyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 9052597 |
| Molecular Formula | C17H11ClN2O4 |
| Molecular Weight | 342.74 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | [3-[(Z)-[2-(4-chloro-2-pyridinyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(/C=C2\N=C(c3cc(Cl)ccn3)OC2=O)c1 |
| InChI | InChI=1S/C17H11ClN2O4/c1-10(21)23-13-4-2-3-11(7-13)8-15-17(22)24-16(20-15)14-9-12(18)5-6-19-14/h2-9H,1H3/b15-8- |
| InChIKey | ZPPMEGFRLMZPNW-NVNXTCNLSA-N |
| XLogP | 3.00 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|