C23H13ClN2O6 — CID 2269053
[3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate (PubChem CID 2269053) has the molecular formula C23H13ClN2O6 and a molecular weight of 448.82 g/mol. Its IUPAC name is [3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate.
| Compound Name | [3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 2269053 |
| Molecular Formula | C23H13ClN2O6 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | [3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-nitrobenzoate |
| SMILES | O=C1OC(c2cccc(Cl)c2)=N/C1=C\c1cccc(OC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H13ClN2O6/c24-17-7-2-5-15(12-17)21-25-20(23(28)32-21)11-14-4-1-9-19(10-14)31-22(27)16-6-3-8-18(13-16)26(29)30/h1-13H/b20-11- |
| InChIKey | PBDUKOBKVINTNE-JAIQZWGSSA-N |
| XLogP | 4.81 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|