C13H7ClN2O3 — CID 9052520
(4Z)-2-(4-chloro-2-pyridinyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 9052520) has the molecular formula C13H7ClN2O3 and a molecular weight of 274.66 g/mol. Its IUPAC name is (4Z)-2-(4-chloro-2-pyridinyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-chloro-2-pyridinyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9052520 |
| Molecular Formula | C13H7ClN2O3 |
| Molecular Weight | 274.66 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (4Z)-2-(4-chloro-2-pyridinyl)-4-(furan-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc(Cl)ccn2)=N/C1=C\c1ccco1 |
| InChI | InChI=1S/C13H7ClN2O3/c14-8-3-4-15-10(6-8)12-16-11(13(17)19-12)7-9-2-1-5-18-9/h1-7H/b11-7- |
| InChIKey | JHLVDFWLZSWLRF-XFFZJAGNSA-N |
| XLogP | 2.67 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.66 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|