C14H7Cl2NO3 — CID 5411455
(4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 5411455) has the molecular formula C14H7Cl2NO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5411455 |
| Molecular Formula | C14H7Cl2NO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccco2)=N/C1=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H7Cl2NO3/c15-9-4-3-8(10(16)7-9)6-11-14(18)20-13(17-11)12-2-1-5-19-12/h1-7H/b11-6- |
| InChIKey | ZXQIPXWURBZHRX-WDZFZDKYSA-N |
| XLogP | 3.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|