C18H9Cl4NO2 — CID 5185948
2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(2,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 5185948) has the molecular formula C18H9Cl4NO2 and a molecular weight of 413.09 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(2,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(2,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5185948 |
| Molecular Formula | C18H9Cl4NO2 |
| Molecular Weight | 413.09 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(2,4-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(C=Cc2ccc(Cl)cc2Cl)=NC1=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H9Cl4NO2/c19-12-4-1-10(14(21)8-12)3-6-17-23-16(18(24)25-17)7-11-2-5-13(20)9-15(11)22/h1-9H |
| InChIKey | JOKDJVILSPSYLV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.09 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|