C18H10Cl3NO2 — CID 6260137
(4E)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 6260137) has the molecular formula C18H10Cl3NO2 and a molecular weight of 378.64 g/mol. Its IUPAC name is (4E)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6260137 |
| Molecular Formula | C18H10Cl3NO2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | (4E)-2-[(E)-2-(4-chlorophenyl)ethenyl]-4-[(2,3-dichlorophenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | O=C1OC(/C=C/c2ccc(Cl)cc2)=N/C1=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H10Cl3NO2/c19-13-7-4-11(5-8-13)6-9-16-22-15(18(23)24-16)10-12-2-1-3-14(20)17(12)21/h1-10H/b9-6+,15-10+ |
| InChIKey | LXRAKYVBZGZDLB-UJHPFZFGSA-N |
| XLogP | 5.66 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|