C18H10BrCl2NO2 — CID 4216674
4-[(3-bromophenyl)methylidene]-2-[2-(2,3-dichlorophenyl)ethenyl]-1,3-oxazol-5-one (PubChem CID 4216674) has the molecular formula C18H10BrCl2NO2 and a molecular weight of 423.09 g/mol. Its IUPAC name is 4-[(3-bromophenyl)methylidene]-2-[2-(2,3-dichlorophenyl)ethenyl]-1,3-oxazol-5-one.
| Compound Name | 4-[(3-bromophenyl)methylidene]-2-[2-(2,3-dichlorophenyl)ethenyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4216674 |
| Molecular Formula | C18H10BrCl2NO2 |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 4-[(3-bromophenyl)methylidene]-2-[2-(2,3-dichlorophenyl)ethenyl]-1,3-oxazol-5-one |
| SMILES | O=C1OC(C=Cc2cccc(Cl)c2Cl)=NC1=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H10BrCl2NO2/c19-13-5-1-3-11(9-13)10-15-18(23)24-16(22-15)8-7-12-4-2-6-14(20)17(12)21/h1-10H |
| InChIKey | SWPOCAUYZXYMTK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|