C21H15Cl2NO5 — CID 45105493
[5-[(Z)-[2-[(E)-2-(2,3-dichlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 45105493) has the molecular formula C21H15Cl2NO5 and a molecular weight of 432.26 g/mol. Its IUPAC name is [5-[(Z)-[2-[(E)-2-(2,3-dichlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [5-[(Z)-[2-[(E)-2-(2,3-dichlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 45105493 |
| Molecular Formula | C21H15Cl2NO5 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | [5-[(Z)-[2-[(E)-2-(2,3-dichlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc(/C=C2\N=C(/C=C/c3cccc(Cl)c3Cl)OC2=O)cc1OC(C)=O |
| InChI | InChI=1S/C21H15Cl2NO5/c1-12(25)28-18-11-13(6-8-17(18)27-2)10-16-21(26)29-19(24-16)9-7-14-4-3-5-15(22)20(14)23/h3-11H,1-2H3/b9-7+,16-10- |
| InChIKey | VUDOEFRRMQBXHQ-TVENYDQUSA-N |
| XLogP | 4.94 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|