C21H15BrClNO5 — CID 5011362
[2-bromo-4-[[2-[2-(4-chlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] acetate (PubChem CID 5011362) has the molecular formula C21H15BrClNO5 and a molecular weight of 476.71 g/mol. Its IUPAC name is [2-bromo-4-[[2-[2-(4-chlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] acetate.
| Compound Name | [2-bromo-4-[[2-[2-(4-chlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 5011362 |
| Molecular Formula | C21H15BrClNO5 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | [2-bromo-4-[[2-[2-(4-chlorophenyl)ethenyl]-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C2N=C(C=Cc3ccc(Cl)cc3)OC2=O)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C21H15BrClNO5/c1-12(25)28-20-16(22)9-14(11-18(20)27-2)10-17-21(26)29-19(24-17)8-5-13-3-6-15(23)7-4-13/h3-11H,1-2H3 |
| InChIKey | OAQSAGUSIBPBTM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|