C19H13Cl2NO5 — CID 1080171
[4-[(E)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 1080171) has the molecular formula C19H13Cl2NO5 and a molecular weight of 406.22 g/mol. Its IUPAC name is [4-[(E)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1080171 |
| Molecular Formula | C19H13Cl2NO5 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | [4-[(E)-[2-(2,4-dichlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C2/N=C(c3ccc(Cl)cc3Cl)OC2=O)ccc1OC(C)=O |
| InChI | InChI=1S/C19H13Cl2NO5/c1-10(23)26-16-6-3-11(8-17(16)25-2)7-15-19(24)27-18(22-15)13-5-4-12(20)9-14(13)21/h3-9H,1-2H3/b15-7+ |
| InChIKey | DKDBUOQVOGRQKZ-VIZOYTHASA-N |
| XLogP | 4.27 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|