C22H14ClNO2 — CID 5011359
2-[2-(4-chlorophenyl)ethenyl]-4-(naphthalen-1-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 5011359) has the molecular formula C22H14ClNO2 and a molecular weight of 359.81 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethenyl]-4-(naphthalen-1-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | 2-[2-(4-chlorophenyl)ethenyl]-4-(naphthalen-1-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5011359 |
| Molecular Formula | C22H14ClNO2 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethenyl]-4-(naphthalen-1-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC(C=Cc2ccc(Cl)cc2)=NC1=Cc1cccc2ccccc12 |
| InChI | InChI=1S/C22H14ClNO2/c23-18-11-8-15(9-12-18)10-13-21-24-20(22(25)26-21)14-17-6-3-5-16-4-1-2-7-19(16)17/h1-14H |
| InChIKey | JWGWPSOTNFUVHR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|