C17H11Cl2NO2S — CID 4674558
2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(3-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 4674558) has the molecular formula C17H11Cl2NO2S and a molecular weight of 364.25 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(3-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(3-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4674558 |
| Molecular Formula | C17H11Cl2NO2S |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)ethenyl]-4-[(3-methylthiophen-2-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | Cc1ccsc1C=C1N=C(C=Cc2ccc(Cl)cc2Cl)OC1=O |
| InChI | InChI=1S/C17H11Cl2NO2S/c1-10-6-7-23-15(10)9-14-17(21)22-16(20-14)5-3-11-2-4-12(18)8-13(11)19/h2-9H,1H3 |
| InChIKey | KRJWZWMOWSYFMR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|