C15H13Cl2NO3 — CID 108937268
(4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one (PubChem CID 108937268) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108937268 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (4Z)-4-[(2,4-dichlorophenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(C2CCOCC2)=N/C1=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2NO3/c16-11-2-1-10(12(17)8-11)7-13-15(19)21-14(18-13)9-3-5-20-6-4-9/h1-2,7-9H,3-6H2/b13-7- |
| InChIKey | WBTBQCFJOKNCRJ-QPEQYQDCSA-N |
| XLogP | 3.72 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|