C16H17NO4 — CID 108936245
(4Z)-4-[(2-methoxyphenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one (PubChem CID 108936245) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (4Z)-4-[(2-methoxyphenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2-methoxyphenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 108936245 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (4Z)-4-[(2-methoxyphenyl)methylidene]-2-(oxan-4-yl)-1,3-oxazol-5-one |
| SMILES | COc1ccccc1/C=C1\N=C(C2CCOCC2)OC1=O |
| InChI | InChI=1S/C16H17NO4/c1-19-14-5-3-2-4-12(14)10-13-16(18)21-15(17-13)11-6-8-20-9-7-11/h2-5,10-11H,6-9H2,1H3/b13-10- |
| InChIKey | VOBIWVAPQWTINO-RAXLEYEMSA-N |
| XLogP | 2.42 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|