C19H22ClNO2 — CID 4093059
4-[(3-chlorophenyl)methylidene]-2-(4-propylcyclohexyl)-1,3-oxazol-5-one (PubChem CID 4093059) has the molecular formula C19H22ClNO2 and a molecular weight of 331.84 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methylidene]-2-(4-propylcyclohexyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(3-chlorophenyl)methylidene]-2-(4-propylcyclohexyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4093059 |
| Molecular Formula | C19H22ClNO2 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-[(3-chlorophenyl)methylidene]-2-(4-propylcyclohexyl)-1,3-oxazol-5-one |
| SMILES | CCCC1CCC(C2=NC(=Cc3cccc(Cl)c3)C(=O)O2)CC1 |
| InChI | InChI=1S/C19H22ClNO2/c1-2-4-13-7-9-15(10-8-13)18-21-17(19(22)23-18)12-14-5-3-6-16(20)11-14/h3,5-6,11-13,15H,2,4,7-10H2,1H3 |
| InChIKey | AELJHKUKJYDOCZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|