C15H8ClNO5 — CID 19663158
(4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 19663158) has the molecular formula C15H8ClNO5 and a molecular weight of 317.68 g/mol. Its IUPAC name is (4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19663158 |
| Molecular Formula | C15H8ClNO5 |
| Molecular Weight | 317.68 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (4Z)-4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccco2)=N/C1=C\c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C15H8ClNO5/c16-9-6-13-12(20-7-21-13)5-8(9)4-10-15(18)22-14(17-10)11-2-1-3-19-11/h1-6H,7H2/b10-4- |
| InChIKey | ABLRESHDIBJWCG-WMZJFQQLSA-N |
| XLogP | 3.01 |
| TPSA | 70.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.68 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|