C17H8BrCl2NO4 — CID 1354625
4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 1354625) has the molecular formula C17H8BrCl2NO4 and a molecular weight of 441.06 g/mol. Its IUPAC name is 4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1354625 |
| Molecular Formula | C17H8BrCl2NO4 |
| Molecular Weight | 441.06 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 4-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-2-(2,5-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cc(Cl)ccc2Cl)=NC1=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C17H8BrCl2NO4/c18-11-6-15-14(23-7-24-15)4-8(11)3-13-17(22)25-16(21-13)10-5-9(19)1-2-12(10)20/h1-6H,7H2 |
| InChIKey | NCNOYGHUCBMXQN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.06 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|