C18H12ClNO4 — CID 740091
4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5-one (PubChem CID 740091) has the molecular formula C18H12ClNO4 and a molecular weight of 341.75 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 740091 |
| Molecular Formula | C18H12ClNO4 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-2-(4-methylphenyl)-1,3-oxazol-5-one |
| SMILES | Cc1ccc(C2=NC(=Cc3cc4c(cc3Cl)OCO4)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H12ClNO4/c1-10-2-4-11(5-3-10)17-20-14(18(21)24-17)6-12-7-15-16(8-13(12)19)23-9-22-15/h2-8H,9H2,1H3 |
| InChIKey | ZWYMKJGTFLOSGA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|